|
Product category: | organic intermediate | English Name: | Indole-2-carboxylic acid | CAS No.: | 1477-50-5 | Molecular weight: | 161.15 | ECNO: | 216-030-4 | Molecular formula: | C9H7NO2 | InChl: | InChI=1/C9H7NO2/c11-9(12)8-5-6-3-1-2-4-7(6)10-8/h1-5,10H,(H,11,12)/p-1 | Specifications: | ≥99.0% | Product introduction: | CAS No.: 168960-19-8
Appearance: colorless or almost white needle like crystals Content: ≥ 99.0% Molecular formula: c9h7no2 melting point: 206-208 ° C boiling point: 419.6 ° C at 760 mmHg flash point: 207.6 ° C physical and chemical properties: colorless needle like crystal (recrystallized from water) or colorless leaf like crystal (recrystallized from benzene). It is soluble in ethanol and ether, soluble in hot benzene, insoluble in cold water and insoluble in petroleum ether.
|
|
|